13228-39-2 N-Ethyl-2-phenylindole
ürün Ad? |
N-Ethyl-2-phenylindole |
ingilizce ad? |
N-Ethyl-2-phenylindole; 1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
Moleküler Formülü |
C16H15N |
Molekül A??rl??? |
221.297 |
InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
CAS kay?t numaras? |
13228-39-2 |
EINECS |
236-199-8 |
Moleküler Yap?s? |
|
Yo?unluk |
1.03g/cm3 |
Kaynama noktas? |
390.6°C at 760 mmHg |
K?r?lma indisi |
1.59 |
Alevlenme noktas? |
190°C |
Buhar bas?nc? |
5.91E-06mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|