13228-39-2 N-Ethyl-2-phenylindole
Ονομασ?α του προ??ντο? |
N-Ethyl-2-phenylindole |
Αγγλικ? ?νομα |
N-Ethyl-2-phenylindole; 1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
MF |
C16H15N |
Μοριακ? β?ρο? |
221.297 |
InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
CAS ΟΧΙ |
13228-39-2 |
EINECS |
236-199-8 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.03g/cm3 |
Σημε?ο βρασμο? |
390.6°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.59 |
Σημε?ο αν?φλεξη? |
190°C |
Π?εση ατμ?ν |
5.91E-06mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
|
Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|