13228-39-2 N-Ethyl-2-phenylindole
produktnavn |
N-Ethyl-2-phenylindole |
Engelsk navn |
N-Ethyl-2-phenylindole; 1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
Molekyl?r Formel |
C16H15N |
Molekylvekt |
221.297 |
InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
CAS-nummer |
13228-39-2 |
EINECS |
236-199-8 |
Molecular Structure |
|
Tetthet |
1.03g/cm3 |
Kokepunkt |
390.6°C at 760 mmHg |
Brytningsindeks |
1.59 |
Flammepunktet |
190°C |
Damptrykk |
5.91E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|