??? ?????? |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
????? ??????????? |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans; 2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
?????? ???????? |
C6H10O3 |
????? ??????? ??????? |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
?????????? ???????? ??????? |
332-77-4 |
???????? ????????? ??? |
206-367-5 |
???? ?????? |
|
????? |
1.06g/cm3 |
???? ??????? |
161°C at 760 mmHg |
????? ???????? |
1.448 |
???? ?????? |
47.2°C |
??? ?????? |
3.02mmHg at 25°C |
?????? ??? ??????? ?????? |
Xn:Harmful;
|
??? ????????? |
R10:;
|
???? ????? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|