???? |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
?? ?? |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans; 2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
??? |
C6H10O3 |
??? |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
cas?? |
332-77-4 |
EC?? |
206-367-5 |
?? ?? |
|
?? |
1.06g/cm3 |
??? |
161°C at 760 mmHg |
?? ?? |
1.448 |
??? |
47.2°C |
??? |
3.02mmHg at 25°C |
??? ?? |
Xn:Harmful;
|
??? ?? |
R10:;
|
?? ?? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|