produktnavn |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
Engelsk navn |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans; 2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
Molekyl?r Formel |
C6H10O3 |
Molekylvekt |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
CAS-nummer |
332-77-4 |
EINECS |
206-367-5 |
Molecular Structure |
|
Tetthet |
1.06g/cm3 |
Kokepunkt |
161°C at 760 mmHg |
Brytningsindeks |
1.448 |
Flammepunktet |
47.2°C |
Damptrykk |
3.02mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R10:;
|
Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|