818-88-2 mono-methyl sebacate
Nazwa produktu: |
mono-methyl sebacate |
Angielska nazwa |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
MF |
C11H20O4 |
Masie cz?steczkowej |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
Nr CAS |
818-88-2 |
EINECS |
212-458-0 |
Struktury molekularnej |
|
G?sto?? |
1.038g/cm3 |
Temperatura topnienia |
41-44℃ |
Temperatura wrzenia |
332.5°C at 760 mmHg |
Wspó?czynnik za?amania |
1.453 |
Temperatura zap?onu |
115.4°C |
Ci?nienie pary |
2.8E-05mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|