818-88-2 mono-methyl sebacate
???? |
mono-methyl sebacate |
?? ?? |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
??? |
C11H20O4 |
??? |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
cas?? |
818-88-2 |
EC?? |
212-458-0 |
?? ?? |
|
?? |
1.038g/cm3 |
?? ? |
41-44℃ |
??? |
332.5°C at 760 mmHg |
?? ?? |
1.453 |
??? |
115.4°C |
??? |
2.8E-05mmHg at 25°C |
??? ?? |
|
??? ?? |
|
?? ?? |
S24/25:Avoid contact with skin and eyes.;
|
|