818-88-2 mono-methyl sebacate
produktnavn |
mono-methyl sebacate |
Engelsk navn |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
Molekyl?r Formel |
C11H20O4 |
Molekylvekt |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS-nummer |
818-88-2 |
EINECS |
212-458-0 |
Molecular Structure |
|
Tetthet |
1.038g/cm3 |
Smeltepunkt |
41-44℃ |
Kokepunkt |
332.5°C at 760 mmHg |
Brytningsindeks |
1.453 |
Flammepunktet |
115.4°C |
Damptrykk |
2.8E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|