ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
ürün Ad? |
Thiophene-2-carboxylic acid methy lester |
ingilizce ad? |
Thiophene-2-carboxylic acid methy lester; Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
Moleküler Formülü |
C6H6O2S |
Molekül A??rl??? |
142.1756 |
InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
CAS kay?t numaras? |
5380-42-7 |
EINECS |
226-371-0 |
Moleküler Yap?s? |
|
Yo?unluk |
1.217g/cm3 |
Kaynama noktas? |
200.2°C at 760 mmHg |
K?r?lma indisi |
1.535 |
Alevlenme noktas? |
74.9°C |
Buhar bas?nc? |
0.329mmHg at 25°C |
Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|