ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
Naam product |
Thiophene-2-carboxylic acid methy lester |
Engelse naam |
Thiophene-2-carboxylic acid methy lester; Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
MF |
C6H6O2S |
Molecuulgewicht |
142.1756 |
InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
CAS-nummer |
5380-42-7 |
EINECS |
226-371-0 |
Moleculaire Structuur |
|
Dichtheid |
1.217g/cm3 |
Kookpunt |
200.2°C at 760 mmHg |
Brekingsindex |
1.535 |
Vlampunt |
74.9°C |
Dampdruk |
0.329mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|