ChemNet > CAS > 139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
Nazwa produktu: |
4-Fluoro-3-methylbenzeneboronic acid |
Angielska nazwa |
4-Fluoro-3-methylbenzeneboronic acid; 4-Fluoro-3-methylphenylboronic acid; 4-Fluoro-m-tolylboronic acid |
MF |
C7H8BFO2 |
Masie cz?steczkowej |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 |
Nr CAS |
139911-27-6 |
Struktury molekularnej |
|
G?sto?? |
1.2g/cm3 |
Temperatura topnienia |
212-217℃ |
Temperatura wrzenia |
282°C at 760 mmHg |
Wspó?czynnik za?amania |
1.505 |
Temperatura zap?onu |
124.3°C |
Ci?nienie pary |
0.00163mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|