ChemNet > CAS > 139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
???? |
4-Fluoro-3-methylbenzeneboronic acid |
?? ?? |
4-Fluoro-3-methylbenzeneboronic acid; 4-Fluoro-3-methylphenylboronic acid; 4-Fluoro-m-tolylboronic acid |
??? |
C7H8BFO2 |
??? |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 |
cas?? |
139911-27-6 |
?? ?? |
|
?? |
1.2g/cm3 |
?? ? |
212-217℃ |
??? |
282°C at 760 mmHg |
?? ?? |
1.505 |
??? |
124.3°C |
??? |
0.00163mmHg at 25°C |
??? ?? |
|
??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|