878-00-2 4-Acetoxybenzaldehyde
produktnavn |
4-Acetoxybenzaldehyde |
Engelsk navn |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
Molekyl?r Formel |
C9H8O3 |
Molekylvekt |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
CAS-nummer |
878-00-2 |
EINECS |
212-898-3 |
Molecular Structure |
|
Tetthet |
1.183g/cm3 |
Kokepunkt |
275°C at 760 mmHg |
Brytningsindeks |
1.552 |
Flammepunktet |
119.4°C |
Damptrykk |
0.00522mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|