878-00-2 4-Acetoxybenzaldehyde
product Name |
4-Acetoxybenzaldehyde |
CAS No |
878-00-2 |
Synonyms |
4-Formylphenyl acetate |
Molecular Formula |
C9H8O3 |
Molecular Weight |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
EINECS |
212-898-3 |
Molecular Structure |
|
Density |
1.183g/cm3 |
Boiling point |
275°C at 760 mmHg |
Refractive index |
1.552 |
Flash point |
119.4°C |
Vapour Pressur |
0.00522mmHg at 25°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|