4312-99-6 1-Octen-3-one
produktnavn |
1-Octen-3-one |
Engelsk navn |
1-Octen-3-one; n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
Molekyl?r Formel |
C8H14O |
Molekylvekt |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
CAS-nummer |
4312-99-6 |
EINECS |
224-327-5 |
Molecular Structure |
|
Tetthet |
0.825g/cm3 |
Kokepunkt |
177°C at 760 mmHg |
Brytningsindeks |
1.422 |
Flammepunktet |
58.5°C |
Damptrykk |
1.06mmHg at 25°C |
Risiko Koder |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|