4312-99-6 1-Octen-3-one
Produkt-Name |
1-Octen-3-one |
Englischer Name |
1-Octen-3-one; n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
Molekulare Formel |
C8H14O |
Molecular Weight |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
CAS Registry Number |
4312-99-6 |
EINECS |
224-327-5 |
Molecular Structure |
|
Dichte |
0.825g/cm3 |
Siedepunkt |
177°C at 760 mmHg |
Brechungsindex |
1.422 |
Flammpunkt |
58.5°C |
Dampfdruck |
1.06mmHg at 25°C |
Risk Codes |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|