1129-35-7 methyl 4-cyanobenzoate
?????? ?? ??? |
methyl 4-cyanobenzoate |
???????? ??? |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
????? ???????? |
C9H7NO2 |
?????? ??? |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
??? ??????? ?????? |
1129-35-7 |
EINECS |
214-443-4 |
????? ?????? |
|
????? |
1.18g/cm3 |
?????? |
62℃ |
????? ?? ??? |
274.9°C at 760 mmHg |
??????? ??????? |
1.535 |
????? ??????? |
131.2°C |
????? ?? ???? |
0.00526mmHg at 25°C |
???? ?? ??? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
??????? ????? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|