1129-35-7 methyl 4-cyanobenzoate
Ονομασ?α του προ??ντο? |
methyl 4-cyanobenzoate |
Αγγλικ? ?νομα |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
MF |
C9H7NO2 |
Μοριακ? β?ρο? |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
CAS ΟΧΙ |
1129-35-7 |
EINECS |
214-443-4 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.18g/cm3 |
Σημε?ο τ?ξη? |
62℃ |
Σημε?ο βρασμο? |
274.9°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.535 |
Σημε?ο αν?φλεξη? |
131.2°C |
Π?εση ατμ?ν |
0.00526mmHg at 25°C |
Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|