92-32-0 Pyronin Y
ürün Ad? |
Pyronin Y |
ingilizce ad? |
Pyronin Y; C.I. 45005; Pyronine; Pyronin G; PYRONINE G; pyronin Y molecular biology; Pyronin Y, CI 45005; Pyronine Y; N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride |
Moleküler Formülü |
C17H19ClN2O |
Molekül A??rl??? |
302.7986 |
InChI |
InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
CAS kay?t numaras? |
92-32-0 |
EINECS |
202-147-8 |
Moleküler Yap?s? |
|
Ergime noktas? |
250-260℃ |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|