65195-20-2 2-Piperidinophenol
ürün Ad? |
2-Piperidinophenol |
ingilizce ad? |
2-Piperidinophenol; 2-(Piperidin-1-yl)phenol; phenol, 2-(1-piperidinyl)- |
Moleküler Formülü |
C11H15NO |
Molekül A??rl??? |
177.2429 |
InChI |
InChI=1/C11H15NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7,13H,1,4-5,8-9H2 |
CAS kay?t numaras? |
65195-20-2 |
Moleküler Yap?s? |
|
Yo?unluk |
1.106g/cm3 |
Kaynama noktas? |
296.8°C at 760 mmHg |
K?r?lma indisi |
1.575 |
Alevlenme noktas? |
145.3°C |
Buhar bas?nc? |
0.000795mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|