591-08-2 N-Acetylthiourea
ürün Ad? |
N-Acetylthiourea |
ingilizce ad? |
N-Acetylthiourea; N-Acetylthiourea,98%; N-carbamothioylacetamide |
Moleküler Formülü |
C3H6N2OS |
Molekül A??rl??? |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
CAS kay?t numaras? |
591-08-2 |
EINECS |
209-699-9 |
Moleküler Yap?s? |
|
Yo?unluk |
1.275g/cm3 |
Ergime noktas? |
166-168℃ |
Kaynama noktas? |
208.6°C at 760 mmHg |
K?r?lma indisi |
1.569 |
Alevlenme noktas? |
80°C |
Buhar bas?nc? |
0.212mmHg at 25°C |
Tehlike Sembolleri |
T:Toxic;
|
Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|