ChemNet > CAS > 37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
ürün Ad? |
1-(2,4-Dichlorophenyl)-1-propanone |
ingilizce ad? |
1-(2,4-Dichlorophenyl)-1-propanone; 2,4-Dichloropropiophenone; 2',4'-DICHLOROPROPIOPHENONE |
Moleküler Formülü |
C9H8Cl2O |
Molekül A??rl??? |
203.06 |
InChI |
InChI=1/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
CAS kay?t numaras? |
37885-41-9 |
EINECS |
253-700-5 |
Moleküler Yap?s? |
|
Yo?unluk |
1.287 |
K?r?lma indisi |
1.551-1.553 |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|