3586-14-9 3-Phenoxytoluene
ürün Ad? |
3-Phenoxytoluene |
ingilizce ad? |
3-Phenoxytoluene; Phenyl m-tolyl ether; 3-Methyldiphenyl ether; 1-methyl-3-phenoxybenzene |
Moleküler Formülü |
C13H12O |
Molekül A??rl??? |
184.2338 |
InChI |
InChI=1/C13H12O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10H,1H3 |
CAS kay?t numaras? |
3586-14-9 |
EINECS |
222-716-4 |
Moleküler Yap?s? |
|
Yo?unluk |
1.045g/cm3 |
Kaynama noktas? |
269.1°C at 760 mmHg |
K?r?lma indisi |
1.566 |
Alevlenme noktas? |
110.8°C |
Buhar bas?nc? |
0.0122mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|