ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
ürün Ad? |
3-fluoro-4-methoxybenzonitrile |
ingilizce ad? |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
Moleküler Formülü |
C8H6FNO |
Molekül A??rl??? |
151.1377 |
InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS kay?t numaras? |
331-62-4 |
Moleküler Yap?s? |
|
Yo?unluk |
1.18g/cm3 |
Kaynama noktas? |
254.3°C at 760 mmHg |
K?r?lma indisi |
1.505 |
Alevlenme noktas? |
107.6°C |
Buhar bas?nc? |
0.0173mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|