??? ?????? |
(-)-N-????? ????????? ?????? ????? ????? ??????????. 1alphaH ? 5alphaH-Tropanium ? 6beta ? 7beta-epoxy-3alpha-hydroxy-8-methyl- ? ????? ? (-) - ?????? ? 3-?????-9-?????????????? (3.3.1.0(2,4))?????? 7- (3-????????-1-?????-2-????? ????????)-9?9-????? ?????- ? (7(S)-(1alpha,2beta,4beta,5alpha,7beta))-? ????? (???)? ??? ??????? ?????? ? ???? (???????? ?????) - ? 9-????? -3-????? -9-?????????? (3.3.1.0 (2?4)) ???? ??? 7-?? ? (7 (S) - (1-???? ? 2-???? ? 4-???? ? 5-???? ? 7-????)) - ? compd.?? ????? ??????? (1: 1) ? ??????? ?????? ?????? ????? ?????. HSDB 6104 ? ?????? ?????????. ????????. ????????. ????? ???????????????. ????? ??????? ? compd ?? ?????????? ? ????? ????? ??????????? ? ????? ????????????? ??????. ????? ????????????? ????????. ????? ???????????????. ????? N- ????? ??????????. N- ????? ????????????? ?????? ? ???????. ??????????-?-????? ??????. ?????????? ????? ????? ?????????? ? ???? ?? ????? ??????? (1: 1) ? ???????. ????????. ??????. UNII-K0813KQM3V |
????? ???????? |
??????. (-)-N-????? ????????? ?????? 1-????-H ? 5-????-H-????????? ? 6-???? ? 7-????-???????-3-????-????????-8-?????- ? ????? ? (-) - ?????? ? 3-?????-9-?????????????? (3.3.1.02?4) ?????? 7- ((2S)-3-????????-1-?????-2-????? ????????)-9?9-????? ?????- ? (1alpha? 2beta? 4beta? 5alpha? 7beta)-? ????? (1: 1)? 3-?????-9-?????????????? (3.3.1.02?4) ????? ? 7- ((2S) -3-????????-1-?????-2-????? ????????) -9?9-????? ?????- ? (1alpha ? 2beta ? 4beta ? 5alpha ? 7beta) - ? ????? (???) ? ????? ????? ????????????? (6CI ? 7CI) ? (1R ? 2R ? 4S ? 5S ? 7S) -9-?????-3-?????-9-??????????? [3.3.1.02?4] non-7-yl (2S) -3-????????-2-????? ????????? - ????? ??????? (1: 1) ? |
????? ??????????? |
(-)-N-methylhyoscinium nitrate;Methylscopolamine nitrate; 1alphaH,5alphaH-Tropanium, 6beta,7beta-epoxy-3alpha-hydroxy-8-methyl-, nitrate, (-)-tropate; 3-Oxa-9-azoniatricyclo(3.3.1.0(2,4))nonane, 7-(3-hydroxy-1-oxo-2-phenylpropoxy)-9,9-dimethyl-, (7(S)-(1alpha,2beta,4beta,5alpha,7beta))-, nitrate (salt); Benzeneacetic acid, alpha-(hydroxymethyl)-, 9-methyl-3-oxa-9-aztricyclo(3.3.1.0(2,4))non-7-yl ester, (7(S)-(1-alpha,2-beta,4-beta,5-alpha,7-beta))-, compd. with methyl nitrate (1:1); Epoxytropine tropate methylnitrate; HSDB 6104; Hyoscine methonitrate; Mescomine; Methnite; Methscopolamine nitrate; Methyl nitrate, compd with scopolamine; Methylscopolamini nitras; Methylscopolaminium nitrat; Methylscopolaminium nitricum; Methylscopolaminnitrat; N-Methylscopolamine nitrate; N-Methylscopolaminium-nitrat; Pylorpine; Scopolamin-N-methylnitrat; Scopolamine methylnitrate; Scopolamine, compd with methyl nitrate (1:1); Scotrate; Skopolate; Skopyl; UNII-K0813KQM3V; Viscope; (-)-N-Methylhyoscinium nitrate; 1-alpha-H,5-alpha-H-Tropanium, 6-beta,7-beta-epoxy-3-alpha-hydroxy-8-methyl-, nitrate, (-)-tropate; 3-Oxa-9-azoniatricyclo(3.3.1.02,4)nonane, 7-((2S)-3-hydroxy-1-oxo-2-phenylpropoxy)-9,9-dimethyl-, (1alpha,2beta,4beta,5alpha,7beta)-, nitrate (1:1); 3-Oxa-9-azoniatricyclo(3.3.1.02,4)nonane, 7-((2S)-3-hydroxy-1-oxo-2-phenylpropoxy)-9,9-dimethyl-, (1alpha,2beta,4beta,5alpha,7beta)-, nitrate (salt); N-Methylscopolammonium nitrate (6CI,7CI); (1R,2R,4S,5S,7S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl (2S)-3-hydroxy-2-phenylpropanoate - methyl nitrate (1:1) |
?????? ???????? |
C18H24N2O7 |
????? ??????? ??????? |
380.39236 |
InChI |
InChI=1/C17H21NO4.CH3NO3/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;1-5-2(3)4/h2-6,11-16,19H,7-9H2,1H3;1H3/t11-,12-,13-,14+,15-,16+;/m1./s1 |
?????????? ???????? ??????? |
6106-46-3 |
???????? ????????? ??? |
228-065-2 |
???? ?????? |
|
?????? ??? ??????? ?????? |
|
??? ????????? |
|
???? ????? |
|
|