1638-22-8 p-butylphenol
??? ?????? |
p-butylphenol |
????? ??????????? |
p-butylphenol; 4-n-Butylphenol; 4-butylphenol |
?????? ???????? |
C10H14O |
????? ??????? ??????? |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
?????????? ???????? ??????? |
1638-22-8 |
???????? ????????? ??? |
216-672-5 |
???? ?????? |
|
????? |
0.977g/cm3 |
???? ??????? |
246.2°C at 760 mmHg |
????? ???????? |
1.522 |
???? ?????? |
121.5°C |
??? ?????? |
0.0176mmHg at 25°C |
??? ????????? |
R34:Causes burns.;
|
???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|