ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
Название продукта |
dipropylene glycol monomethyl ether, mixture of isomers |
Английское название |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
Молекулярная формула |
C7H16O3 |
Молекулярный вес |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
Регистрационный номер CAS |
34590-94-8 |
EINECS |
252-104-2 |
Молекулярная структура |
|
Плотность |
0.958g/cm3 |
Точка кипения |
155.6°C at 760 mmHg |
Показатель преломления |
1.423 |
Температура вспышки |
47.9°C |
Давление пара |
1.09mmHg at 25°C |
Характеристики безопасности |
S23:;
S24/25:;
|
|