33733-73-2 3-Bromothioanisole
Nazwa produktu: |
3-Bromothioanisole |
Angielska nazwa |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
MF |
C7H7BrOS |
Masie cz?steczkowej |
219.0989 |
InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
Nr CAS |
33733-73-2 |
Struktury molekularnej |
|
G?sto?? |
1.567g/cm3 |
Temperatura wrzenia |
278.106°C at 760 mmHg |
Wspó?czynnik za?amania |
1.616 |
Temperatura zap?onu |
121.995°C |
Ci?nienie pary |
0.007mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S23:;
S24/25:;
|
|