2432-42-0 S-Ethyl thiopropionate
Nazwa produktu: |
S-Ethyl thiopropionate |
Angielska nazwa |
S-Ethyl thiopropionate; Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
MF |
C5H10OS |
Masie cz?steczkowej |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
Nr CAS |
2432-42-0 |
EINECS |
219-405-0 |
Struktury molekularnej |
|
G?sto?? |
0.967g/cm3 |
Temperatura wrzenia |
141.4°C at 760 mmHg |
Wspó?czynnik za?amania |
1.456 |
Temperatura zap?onu |
36°C |
Ci?nienie pary |
5.87mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R10:Flammable.;
|
Bezpieczeństwo opis |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|