ChemNet > CAS > 27339-38-4 3-Formylfuran-2-boronic acid
27339-38-4 3-Formylfuran-2-boronic acid
produktnavn |
3-Formylfuran-2-boronic acid |
Engelsk navn |
3-Formylfuran-2-boronic acid; 2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
Molekyl?r Formel |
C5H5BO4 |
Molekylvekt |
139.9018 |
InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
CAS-nummer |
27339-38-4 |
Molecular Structure |
|
Tetthet |
1.36g/cm3 |
Kokepunkt |
346.6°C at 760 mmHg |
Brytningsindeks |
1.51 |
Flammepunktet |
163.4°C |
Damptrykk |
2.15E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|