ChemNet > CAS > 1884-68-0 2,3,4,5-Tetraphenylthiophene
1884-68-0 2,3,4,5-Tetraphenylthiophene
produktnavn |
2,3,4,5-Tetraphenylthiophene |
Engelsk navn |
2,3,4,5-Tetraphenylthiophene; Tetraphenylthiophene |
Molekyl?r Formel |
C28H20S |
Molekylvekt |
388.5234 |
InChI |
InChI=1/C28H20S/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20H |
CAS-nummer |
1884-68-0 |
EINECS |
217-545-7 |
Molecular Structure |
|
Tetthet |
1.142g/cm3 |
Kokepunkt |
402.2°C at 760 mmHg |
Brytningsindeks |
1.643 |
Flammepunktet |
147.8°C |
Damptrykk |
2.58E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|