818-38-2 diethyl glutarate
Naam product |
diethyl glutarate |
Engelse naam |
diethyl glutarate; Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
MF |
C9H16O4 |
Molecuulgewicht |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
CAS-nummer |
818-38-2 |
EINECS |
212-451-2 |
Moleculaire Structuur |
|
Dichtheid |
1.022g/cm3 |
Kookpunt |
236.5°C at 760 mmHg |
Brekingsindex |
1.427 |
Vlampunt |
96.1°C |
Dampdruk |
0.0472mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|