Naam product |
Isosorbide dimethyl ether |
Engelse naam |
Isosorbide dimethyl ether; 1,4:3,6-Dianhydrosorbitol 2,5-dimethyl ether; Dimethyl isoborbide; O,O-Dimethylisosorbide; 1,4:3,6-Dianhydro-2,5-O-dimethyl-D-glucitol; (3R,6S)-3,6-dimethoxyhexahydrofuro[3,2-b]furan; 1,4:3,6-Dianhydro-D-glucitol dimethyl ether; 1,4:3,6-Dianhydro-D-sorbitol dimethyl ether; Dimethyl Isosorbide; DMI; 1,4:3,6-dianhydro-2,5-di-O-methyl-D-glucitol; 1,4:3,6-dianhydro-2,5-di-O-methylhexitol |
MF |
C8H14O4 |
Molecuulgewicht |
174.1944 |
InChI |
InChI=1/C8H14O4/c1-9-5-3-11-8-6(10-2)4-12-7(5)8/h5-8H,3-4H2,1-2H3 |
CAS-nummer |
5306-85-4 |
EINECS |
226-159-8 |
Moleculaire Structuur |
|
Dichtheid |
1.15g/cm3 |
Kookpunt |
236.4°C at 760 mmHg |
Brekingsindex |
1.465 |
Vlampunt |
108.3°C |
Dampdruk |
0.073mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|