ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
Naam product |
1-Methoxy-4-nitronaphthalene |
Engelse naam |
1-Methoxy-4-nitronaphthalene; methyl 4-nitronaphthyl ether |
MF |
C11H9NO3 |
Molecuulgewicht |
203.1941 |
InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
CAS-nummer |
4900-63-4 |
EINECS |
225-528-0 |
Moleculaire Structuur |
|
Dichtheid |
1.274g/cm3 |
Smeltpunt |
83-85℃ |
Kookpunt |
367.2°C at 760 mmHg |
Brekingsindex |
1.638 |
Vlampunt |
178.3°C |
Dampdruk |
2.93E-05mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|