ChemNet > CAS > 2094-73-7 Ethyl adamantane-1-carboxylate
2094-73-7 Ethyl adamantane-1-carboxylate
Naam product |
Ethyl adamantane-1-carboxylate |
Engelse naam |
Ethyl adamantane-1-carboxylate; Adamantane-1-carboxylic acid ethyl ester; ethyl tricyclo[3.3.1.1~3,7~]decane-1-carboxylate |
MF |
C13H20O2 |
Molecuulgewicht |
208.2967 |
InChI |
InChI=1/C13H20O2/c1-2-15-12(14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,2-8H2,1H3 |
CAS-nummer |
2094-73-7 |
EINECS |
218-253-2 |
Moleculaire Structuur |
|
Dichtheid |
1.106g/cm3 |
Kookpunt |
261.8°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
109.9°C |
Dampdruk |
0.0113mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|