38291-82-6 Valeric acid hydrazide
???? |
Valeric acid hydrazide |
?? ?? |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
??? |
C5H12N2O |
??? |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
cas?? |
38291-82-6 |
EC?? |
253-864-8 |
?? ?? |
|
?? |
0.962g/cm3 |
??? |
260.6°C at 760 mmHg |
?? ?? |
1.449 |
??? |
111.4°C |
??? |
0.0122mmHg at 25°C |
??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|