85-29-0 2,4'-Dichlorobenzophenone
Nome del prodotto |
2,4'-Dichlorobenzophenone |
Nome inglese |
2,4'-Dichlorobenzophenone; Dichlorobenzophenone |
Formula molecolare |
C13H8Cl2O |
Peso Molecolare |
251.11 |
InChI |
InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
Numero CAS |
85-29-0 |
EINECS |
201-596-7 |
Struttura molecolare |
|
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|