?? ????? |
?????? ??????????? |
?????? |
????? ???????????? ((HO)C(O)SC(S)(OH)), OC,OC'-?????? ????; AI3-19742; ???? xanthogen ???? formate; ???"? 403191; ????? ??????, ????, ????????????? ?? O-???? ?????????; ????? ??????, ????-, ????????????? ?? O-???? ????-??????; ????? ???????, ?????, ????????????? ?? O-???? ?????????, O-???? ???? (8CI); ?????? ??????????? ((OH)C(O)SC(S)(OH)); ????? ???????????? ((HO)C(O)SC(S)(OH)), ?????? ????; ????? ????????????, ???? ??????; O,O-diethyl dithiodicarbonate |
?? ????? |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
????????? ??????? |
C6H10O3S2 |
???? ???????? |
194.2718 |
InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
???? CAS |
3278-35-1 |
EINECS |
221-911-1 |
???? ???????? |
|
?????? |
1.242g/cm3 |
????? ????? |
236°C at 760 mmHg |
???? ????? |
1.534 |
????? ???? |
96.5°C |
??? ???? |
0.0487mmHg at 25°C |
Hazard ?????? |
|
??????? ???? |
|
?????? ????? |
|
|