942-92-7 Hexanophenone
termék neve |
Hexanophenone |
Angol név |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
MF |
C12H16O |
Molekulat?meg |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
CAS-szám |
942-92-7 |
EINECS |
213-394-6 |
Molekuláris szerkezete |
|
S?r?ség |
0.942g/cm3 |
Olvadáspont |
25-26℃ |
Forráspont |
265°C at 760 mmHg |
T?résmutató |
1.498 |
Gyulladáspont |
105.5°C |
G?znyomás |
0.0094mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|