ChemNet > CAS > 94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
termék neve |
trans-2-ethoxy-5-(1-propenyl)phenol |
Angol név |
trans-2-ethoxy-5-(1-propenyl)phenol; 2-Ethoxy-5-prop-1-enylphenol; 5-propenylguaethol; Vanitrope; 2-ethoxy-5-(prop-1-en-1-yl)phenol; 2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol; Propenyl guaethol |
MF |
C11H14O2 |
Molekulat?meg |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
CAS-szám |
94-86-0 |
EINECS |
202-370-0 |
Molekuláris szerkezete |
|
S?r?ség |
1.052g/cm3 |
Olvadáspont |
86-88℃ |
Forráspont |
312.8°C at 760 mmHg |
T?résmutató |
1.567 |
Gyulladáspont |
165.2°C |
G?znyomás |
0.000281mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|