ChemNet > CAS > 6496-89-5 2,4-Dimethoxyphenylacetic acid
6496-89-5 2,4-Dimethoxyphenylacetic acid
termék neve |
2,4-Dimethoxyphenylacetic acid |
Angol név |
2,4-Dimethoxyphenylacetic acid;(2,4-dimethoxyphenyl)acetate |
MF |
C10H12O4 |
Molekulat?meg |
195.1925 |
InChI |
InChI=1/C10H12O4/c1-13-8-4-3-7(5-10(11)12)9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)/p-1 |
CAS-szám |
6496-89-5 |
Molekuláris szerkezete |
|
Olvadáspont |
110-113℃ |
Forráspont |
339.7°C at 760 mmHg |
Gyulladáspont |
134.1°C |
G?znyomás |
3.5E-05mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R22:;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|