ChemNet > CAS > 4617-33-8 15-Hydroxypentadecanoic acid
4617-33-8 15-Hydroxypentadecanoic acid
termék neve |
15-Hydroxypentadecanoic acid |
Angol név |
15-Hydroxypentadecanoic acid; 15-hydroxypentadecanoate; Pentadecanoic acid, 15-hydroxy- |
MF |
C15H29O3 |
Molekulat?meg |
257.3895 |
InChI |
InChI=1/C15H30O3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h16H,1-14H2,(H,17,18)/p-1 |
CAS-szám |
4617-33-8 |
EINECS |
225-026-1 |
Molekuláris szerkezete |
|
Olvadáspont |
97℃ |
Forráspont |
400.9°C at 760 mmHg |
Gyulladáspont |
210.4°C |
G?znyomás |
4.3E-08mmHg at 25°C |
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|