10487-71-5 Crotonyl chloride
termék neve |
Crotonyl chloride |
Angol név |
Crotonyl chloride; 2-Butenoyl chloride; But-2-enoyl chloride |
MF |
C4H5ClO |
Molekulat?meg |
104.5349 |
InChI |
InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
CAS-szám |
10487-71-5 |
EINECS |
234-010-3 |
Molekuláris szerkezete |
|
S?r?ség |
1.081g/cm3 |
Forráspont |
124.499°C at 760 mmHg |
T?résmutató |
1.441 |
Gyulladáspont |
35°C |
G?znyomás |
12.707mmHg at 25°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R10:Flammable.;
R34:Causes burns.;
|
Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|