ChemNet > CAS > 1501-06-0 Diethyl 2-acetylglutarate
1501-06-0 Diethyl 2-acetylglutarate
Ονομασ?α του προ??ντο? |
Diethyl 2-acetylglutarate |
Αγγλικ? ?νομα |
Diethyl 2-acetylglutarate; 2-Acetylglutaric acid diethyl ester; diethyl 2-acetylpentanedioate; diethyl (2R)-2-acetylpentanedioate; diethyl (2S)-2-acetylpentanedioate |
MF |
C11H18O5 |
Μοριακ? β?ρο? |
230.2576 |
InChI |
InChI=1/C11H18O5/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h9H,4-7H2,1-3H3/t9-/m0/s1 |
CAS ΟΧΙ |
1501-06-0 |
EINECS |
216-114-0 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.073g/cm3 |
Σημε?ο βρασμο? |
291.2°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.439 |
Σημε?ο αν?φλεξη? |
127.5°C |
Π?εση ατμ?ν |
0.00198mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
|
Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|