ChemNet > CAS > 145240-28-4 4-n-Butylbenzeneboronic acid
145240-28-4 4-n-Butylbenzeneboronic acid
Ονομασ?α του προ??ντο? |
4-n-Butylbenzeneboronic acid |
Αγγλικ? ?νομα |
4-n-Butylbenzeneboronic acid; 4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
MF |
C10H15BO2 |
Μοριακ? β?ρο? |
178.0359 |
InChI |
InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
CAS ΟΧΙ |
145240-28-4 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.03g/cm3 |
Σημε?ο τ?ξη? |
91-97℃ |
Σημε?ο βρασμο? |
313.5°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.512 |
Σημε?ο αν?φλεξη? |
143.4°C |
Π?εση ατμ?ν |
0.00021mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|