ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
Ονομασ?α του προ??ντο? |
4-n-Pentylbenzeneboronic acid |
Αγγλικ? ?νομα |
4-n-Pentylbenzeneboronic acid; 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
MF |
C11H17BO2 |
Μοριακ? β?ρο? |
192.0625 |
InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
CAS ΟΧΙ |
121219-12-3 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.01g/cm3 |
Σημε?ο βρασμο? |
328°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.509 |
Σημε?ο αν?φλεξη? |
152.2°C |
Π?εση ατμ?ν |
7.85E-05mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|