495-69-2 Hippuric acid
product Name |
Hippuric acid |
CAS No |
495-69-2;21251-67-2;66407-11-2;140480-84-8;892119-18-5;892119-19-6 |
Synonyms |
N-Benzoylglycine; [(phenylcarbonyl)amino]acetate; 2-benzamidoacetic acid; Bz-Gly-OH |
Molecular Formula |
C9H8NO3 |
Molecular Weight |
178.1653 |
InChI |
InChI=1/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1 |
EINECS |
207-806-3 |
Molecular Structure |
|
Melting point |
188-191℃ |
Boiling point |
464.1°C at 760 mmHg |
Flash point |
234.5°C |
Vapour Pressur |
2.06E-09mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|