4265-27-4 2-butylbenzofuran
product Name |
2-butylbenzofuran |
CAS No |
4265-27-4 |
Synonyms |
2-n-Butylbenzofuran; 2-n-Butylbenzo[b]furan; 2-butyl-1-benzofuran |
Molecular Formula |
C12H14O |
Molecular Weight |
174.239 |
InChI |
InChI=1/C12H14O/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h4-6,8-9H,2-3,7H2,1H3 |
EINECS |
224-250-7 |
Molecular Structure |
|
Density |
1.011g/cm3 |
Boiling point |
248.1°C at 760 mmHg |
Refractive index |
1.554 |
Flash point |
101.1°C |
Vapour Pressur |
0.039mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|