3396-11-0 Cesium acetate
Produkt-Name |
Cesium acetate |
Englischer Name |
Cesium acetate; Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
Molekulare Formel |
C2H3CsO2 |
Molecular Weight |
191.9495 |
InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
CAS Registry Number |
3396-11-0 |
EINECS |
222-248-0 |
Molecular Structure |
|
Schmelzpunkt |
194-195℃ |
Siedepunkt |
117.1°C at 760 mmHg |
Flammpunkt |
40°C |
Dampfdruck |
13.9mmHg at 25°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|